2015-05-06 12:47:20 +00:00
|
|
|
/*
|
|
|
|
* PROJECT: ReactOS Standard Print Processor
|
2017-09-29 17:18:19 +00:00
|
|
|
* LICENSE: GPL-2.0+ (https://spdx.org/licenses/GPL-2.0+)
|
2015-05-06 12:47:20 +00:00
|
|
|
* PURPOSE: Main functions
|
2017-09-29 17:18:19 +00:00
|
|
|
* COPYRIGHT: Copyright 2015-2017 Colin Finck (colin@reactos.org)
|
2015-05-06 12:47:20 +00:00
|
|
|
*/
|
|
|
|
|
|
|
|
#include "precomp.h"
|
|
|
|
|
2015-06-28 15:51:32 +00:00
|
|
|
// Local Constants
|
2019-01-06 11:18:40 +00:00
|
|
|
static PCWSTR _pwszDatatypes[] = {
|
Time to commit some Work-In-Progress stuff before my diff gets too large..
[LOCALSPL]
- Begin work on the Local Spooler. Return a structure with function pointers in InitializePrintProvidor.
- Design and document internal structures for managing LocalSpl Handles, Printer Handles, Printers, Print Jobs and Print Processors.
Manage Printers and Print Processors in Generic Tables, with one Job Queue per Printer managed as a Doubly Linked List.
- Implement LocalOpenPrinter, LocalEnumPrintProcessorDatatypes, LocalEnumPrintProcessors, LocalGetPrintProcessorDirectory, with focus on catching all corner cases.
Currently working on LocalStartDocPrinter.
- Build upon the documentation at http://www.undocprint.org/formats/winspool/shd to read and write .SHD files.
[WINPRINT]
Begin work on the Standard Print Processor. Implement EnumPrintProcessorDatatypesW.
[WINSPOOL_APITEST]
Add an API Test for winspool.drv, currently testing some corner cases of ClosePrinter, EnumPrintProcessorDatatypesW, GetPrintProcessorDirectoryW, OpenPrinterW, StartDocPrinterW.
TODO: Find a way to actually test the localspl.dll functions instead of only winspool.drv. This DLL doesn't like to be tested standalone under Windows, e.g. without being used through spoolsv/spoolss.
[SPOOLSS]
Implement InitializeRouter by calling the InitializePrintProvidor function of localspl there.
This function should later also initialize further Print Providers.
[SPOOLSV]
Call InitializeRouter when starting up the service.
[WINSPOOL]
Add dummy functions for EnumPrintProcessorDatatypesA/EnumPrintProcessorDatatypesW.
[All modules]
Fix printf format specifiers for errors (%lu) and statuses (%ld).
svn path=/branches/colins-printing-for-freedom/; revision=67847
2015-05-22 15:29:07 +00:00
|
|
|
L"RAW",
|
|
|
|
0
|
|
|
|
};
|
|
|
|
|
2015-06-28 15:51:32 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* @name ClosePrintProcessor
|
|
|
|
*
|
|
|
|
* Closes a Print Processor Handle that has previously been opened through OpenPrintProcessor.
|
|
|
|
*
|
|
|
|
* @param hPrintProcessor
|
|
|
|
* The return value of a previous successful OpenPrintProcessor call.
|
|
|
|
*
|
|
|
|
* @return
|
|
|
|
* TRUE if the Print Processor Handle was successfully closed, FALSE otherwise.
|
|
|
|
* A more specific error code can be obtained through GetLastError.
|
|
|
|
*/
|
|
|
|
BOOL WINAPI
|
|
|
|
ClosePrintProcessor(HANDLE hPrintProcessor)
|
|
|
|
{
|
|
|
|
DWORD dwErrorCode;
|
|
|
|
PWINPRINT_HANDLE pHandle;
|
|
|
|
|
2015-07-21 13:19:14 +00:00
|
|
|
TRACE("ClosePrintProcessor(%p)\n", hPrintProcessor);
|
|
|
|
|
2015-06-28 15:51:32 +00:00
|
|
|
// Sanity checks
|
|
|
|
if (!hPrintProcessor)
|
|
|
|
{
|
|
|
|
dwErrorCode = ERROR_INVALID_HANDLE;
|
|
|
|
goto Cleanup;
|
|
|
|
}
|
|
|
|
|
|
|
|
pHandle = (PWINPRINT_HANDLE)hPrintProcessor;
|
|
|
|
|
|
|
|
// Free all structure fields for which memory has been allocated.
|
|
|
|
if (pHandle->pwszDatatype)
|
|
|
|
DllFreeSplStr(pHandle->pwszDatatype);
|
|
|
|
|
|
|
|
if (pHandle->pwszDocumentName)
|
|
|
|
DllFreeSplStr(pHandle->pwszDocumentName);
|
|
|
|
|
|
|
|
if (pHandle->pwszOutputFile)
|
|
|
|
DllFreeSplStr(pHandle->pwszOutputFile);
|
|
|
|
|
|
|
|
if (pHandle->pwszPrinterPort)
|
|
|
|
DllFreeSplStr(pHandle->pwszPrinterPort);
|
|
|
|
|
|
|
|
// Finally free the WINSPOOL_HANDLE structure itself.
|
|
|
|
DllFreeSplMem(pHandle);
|
|
|
|
dwErrorCode = ERROR_SUCCESS;
|
|
|
|
|
|
|
|
Cleanup:
|
|
|
|
SetLastError(dwErrorCode);
|
|
|
|
return (dwErrorCode == ERROR_SUCCESS);
|
|
|
|
}
|
|
|
|
|
|
|
|
BOOL WINAPI
|
|
|
|
ControlPrintProcessor(HANDLE hPrintProcessor, DWORD Command)
|
|
|
|
{
|
2015-07-21 13:19:14 +00:00
|
|
|
TRACE("ControlPrintProcessor(%p, %lu)\n", hPrintProcessor, Command);
|
|
|
|
|
2015-06-28 15:51:32 +00:00
|
|
|
UNIMPLEMENTED;
|
|
|
|
return FALSE;
|
|
|
|
}
|
|
|
|
|
Time to commit some Work-In-Progress stuff before my diff gets too large..
[LOCALSPL]
- Begin work on the Local Spooler. Return a structure with function pointers in InitializePrintProvidor.
- Design and document internal structures for managing LocalSpl Handles, Printer Handles, Printers, Print Jobs and Print Processors.
Manage Printers and Print Processors in Generic Tables, with one Job Queue per Printer managed as a Doubly Linked List.
- Implement LocalOpenPrinter, LocalEnumPrintProcessorDatatypes, LocalEnumPrintProcessors, LocalGetPrintProcessorDirectory, with focus on catching all corner cases.
Currently working on LocalStartDocPrinter.
- Build upon the documentation at http://www.undocprint.org/formats/winspool/shd to read and write .SHD files.
[WINPRINT]
Begin work on the Standard Print Processor. Implement EnumPrintProcessorDatatypesW.
[WINSPOOL_APITEST]
Add an API Test for winspool.drv, currently testing some corner cases of ClosePrinter, EnumPrintProcessorDatatypesW, GetPrintProcessorDirectoryW, OpenPrinterW, StartDocPrinterW.
TODO: Find a way to actually test the localspl.dll functions instead of only winspool.drv. This DLL doesn't like to be tested standalone under Windows, e.g. without being used through spoolsv/spoolss.
[SPOOLSS]
Implement InitializeRouter by calling the InitializePrintProvidor function of localspl there.
This function should later also initialize further Print Providers.
[SPOOLSV]
Call InitializeRouter when starting up the service.
[WINSPOOL]
Add dummy functions for EnumPrintProcessorDatatypesA/EnumPrintProcessorDatatypesW.
[All modules]
Fix printf format specifiers for errors (%lu) and statuses (%ld).
svn path=/branches/colins-printing-for-freedom/; revision=67847
2015-05-22 15:29:07 +00:00
|
|
|
/**
|
|
|
|
* @name EnumPrintProcessorDatatypesW
|
|
|
|
*
|
|
|
|
* Obtains an array of all datatypes supported by this Print Processor.
|
|
|
|
*
|
|
|
|
* @param pName
|
|
|
|
* Server Name. Ignored here, because every caller of EnumPrintProcessorDatatypesW is interested in this Print Processor's information.
|
|
|
|
*
|
|
|
|
* @param pPrintProcessorName
|
|
|
|
* Print Processor Name. Ignored here, because every caller of EnumPrintProcessorDatatypesW is interested in this Print Processor's information.
|
|
|
|
*
|
|
|
|
* @param Level
|
|
|
|
* The level of the structure supplied through pDatatypes. This must be 1.
|
|
|
|
*
|
|
|
|
* @param pDatatypes
|
|
|
|
* Pointer to the buffer that receives an array of DATATYPES_INFO_1W structures.
|
|
|
|
* Can be NULL if you just want to know the required size of the buffer.
|
|
|
|
*
|
|
|
|
* @param cbBuf
|
|
|
|
* Size of the buffer you supplied for pDatatypes, in bytes.
|
|
|
|
*
|
|
|
|
* @param pcbNeeded
|
|
|
|
* Pointer to a variable that receives the required size of the buffer for pDatatypes, in bytes.
|
|
|
|
* This parameter mustn't be NULL!
|
|
|
|
*
|
|
|
|
* @param pcReturned
|
|
|
|
* Pointer to a variable that receives the number of elements of the DATATYPES_INFO_1W array.
|
|
|
|
* This parameter mustn't be NULL!
|
|
|
|
*
|
|
|
|
* @return
|
|
|
|
* TRUE if we successfully copied the array into pDatatypes, FALSE otherwise.
|
|
|
|
* A more specific error code can be obtained through GetLastError.
|
|
|
|
*/
|
|
|
|
BOOL WINAPI
|
2015-07-21 13:19:14 +00:00
|
|
|
EnumPrintProcessorDatatypesW(PWSTR pName, PWSTR pPrintProcessorName, DWORD Level, PBYTE pDatatypes, DWORD cbBuf, PDWORD pcbNeeded, PDWORD pcReturned)
|
Time to commit some Work-In-Progress stuff before my diff gets too large..
[LOCALSPL]
- Begin work on the Local Spooler. Return a structure with function pointers in InitializePrintProvidor.
- Design and document internal structures for managing LocalSpl Handles, Printer Handles, Printers, Print Jobs and Print Processors.
Manage Printers and Print Processors in Generic Tables, with one Job Queue per Printer managed as a Doubly Linked List.
- Implement LocalOpenPrinter, LocalEnumPrintProcessorDatatypes, LocalEnumPrintProcessors, LocalGetPrintProcessorDirectory, with focus on catching all corner cases.
Currently working on LocalStartDocPrinter.
- Build upon the documentation at http://www.undocprint.org/formats/winspool/shd to read and write .SHD files.
[WINPRINT]
Begin work on the Standard Print Processor. Implement EnumPrintProcessorDatatypesW.
[WINSPOOL_APITEST]
Add an API Test for winspool.drv, currently testing some corner cases of ClosePrinter, EnumPrintProcessorDatatypesW, GetPrintProcessorDirectoryW, OpenPrinterW, StartDocPrinterW.
TODO: Find a way to actually test the localspl.dll functions instead of only winspool.drv. This DLL doesn't like to be tested standalone under Windows, e.g. without being used through spoolsv/spoolss.
[SPOOLSS]
Implement InitializeRouter by calling the InitializePrintProvidor function of localspl there.
This function should later also initialize further Print Providers.
[SPOOLSV]
Call InitializeRouter when starting up the service.
[WINSPOOL]
Add dummy functions for EnumPrintProcessorDatatypesA/EnumPrintProcessorDatatypesW.
[All modules]
Fix printf format specifiers for errors (%lu) and statuses (%ld).
svn path=/branches/colins-printing-for-freedom/; revision=67847
2015-05-22 15:29:07 +00:00
|
|
|
{
|
|
|
|
DWORD cbDatatype;
|
2015-07-03 09:06:35 +00:00
|
|
|
DWORD dwDatatypeCount = 0;
|
2015-06-28 15:51:32 +00:00
|
|
|
DWORD dwOffsets[_countof(_pwszDatatypes)];
|
2019-01-06 11:18:40 +00:00
|
|
|
PCWSTR* pCurrentDatatype;
|
2015-06-05 18:16:51 +00:00
|
|
|
PDWORD pCurrentOffset = dwOffsets;
|
Time to commit some Work-In-Progress stuff before my diff gets too large..
[LOCALSPL]
- Begin work on the Local Spooler. Return a structure with function pointers in InitializePrintProvidor.
- Design and document internal structures for managing LocalSpl Handles, Printer Handles, Printers, Print Jobs and Print Processors.
Manage Printers and Print Processors in Generic Tables, with one Job Queue per Printer managed as a Doubly Linked List.
- Implement LocalOpenPrinter, LocalEnumPrintProcessorDatatypes, LocalEnumPrintProcessors, LocalGetPrintProcessorDirectory, with focus on catching all corner cases.
Currently working on LocalStartDocPrinter.
- Build upon the documentation at http://www.undocprint.org/formats/winspool/shd to read and write .SHD files.
[WINPRINT]
Begin work on the Standard Print Processor. Implement EnumPrintProcessorDatatypesW.
[WINSPOOL_APITEST]
Add an API Test for winspool.drv, currently testing some corner cases of ClosePrinter, EnumPrintProcessorDatatypesW, GetPrintProcessorDirectoryW, OpenPrinterW, StartDocPrinterW.
TODO: Find a way to actually test the localspl.dll functions instead of only winspool.drv. This DLL doesn't like to be tested standalone under Windows, e.g. without being used through spoolsv/spoolss.
[SPOOLSS]
Implement InitializeRouter by calling the InitializePrintProvidor function of localspl there.
This function should later also initialize further Print Providers.
[SPOOLSV]
Call InitializeRouter when starting up the service.
[WINSPOOL]
Add dummy functions for EnumPrintProcessorDatatypesA/EnumPrintProcessorDatatypesW.
[All modules]
Fix printf format specifiers for errors (%lu) and statuses (%ld).
svn path=/branches/colins-printing-for-freedom/; revision=67847
2015-05-22 15:29:07 +00:00
|
|
|
|
2015-07-21 13:19:14 +00:00
|
|
|
TRACE("EnumPrintProcessorDatatypesW(%S, %S, %lu, %p, %lu, %p, %p)\n", pName, pPrintProcessorName, Level, pDatatypes, cbBuf, pcbNeeded, pcReturned);
|
|
|
|
|
Time to commit some Work-In-Progress stuff before my diff gets too large..
[LOCALSPL]
- Begin work on the Local Spooler. Return a structure with function pointers in InitializePrintProvidor.
- Design and document internal structures for managing LocalSpl Handles, Printer Handles, Printers, Print Jobs and Print Processors.
Manage Printers and Print Processors in Generic Tables, with one Job Queue per Printer managed as a Doubly Linked List.
- Implement LocalOpenPrinter, LocalEnumPrintProcessorDatatypes, LocalEnumPrintProcessors, LocalGetPrintProcessorDirectory, with focus on catching all corner cases.
Currently working on LocalStartDocPrinter.
- Build upon the documentation at http://www.undocprint.org/formats/winspool/shd to read and write .SHD files.
[WINPRINT]
Begin work on the Standard Print Processor. Implement EnumPrintProcessorDatatypesW.
[WINSPOOL_APITEST]
Add an API Test for winspool.drv, currently testing some corner cases of ClosePrinter, EnumPrintProcessorDatatypesW, GetPrintProcessorDirectoryW, OpenPrinterW, StartDocPrinterW.
TODO: Find a way to actually test the localspl.dll functions instead of only winspool.drv. This DLL doesn't like to be tested standalone under Windows, e.g. without being used through spoolsv/spoolss.
[SPOOLSS]
Implement InitializeRouter by calling the InitializePrintProvidor function of localspl there.
This function should later also initialize further Print Providers.
[SPOOLSV]
Call InitializeRouter when starting up the service.
[WINSPOOL]
Add dummy functions for EnumPrintProcessorDatatypesA/EnumPrintProcessorDatatypesW.
[All modules]
Fix printf format specifiers for errors (%lu) and statuses (%ld).
svn path=/branches/colins-printing-for-freedom/; revision=67847
2015-05-22 15:29:07 +00:00
|
|
|
// Sanity checks
|
|
|
|
if (Level != 1 || !pcbNeeded || !pcReturned)
|
2017-06-27 07:25:04 +00:00
|
|
|
return FALSE;
|
Time to commit some Work-In-Progress stuff before my diff gets too large..
[LOCALSPL]
- Begin work on the Local Spooler. Return a structure with function pointers in InitializePrintProvidor.
- Design and document internal structures for managing LocalSpl Handles, Printer Handles, Printers, Print Jobs and Print Processors.
Manage Printers and Print Processors in Generic Tables, with one Job Queue per Printer managed as a Doubly Linked List.
- Implement LocalOpenPrinter, LocalEnumPrintProcessorDatatypes, LocalEnumPrintProcessors, LocalGetPrintProcessorDirectory, with focus on catching all corner cases.
Currently working on LocalStartDocPrinter.
- Build upon the documentation at http://www.undocprint.org/formats/winspool/shd to read and write .SHD files.
[WINPRINT]
Begin work on the Standard Print Processor. Implement EnumPrintProcessorDatatypesW.
[WINSPOOL_APITEST]
Add an API Test for winspool.drv, currently testing some corner cases of ClosePrinter, EnumPrintProcessorDatatypesW, GetPrintProcessorDirectoryW, OpenPrinterW, StartDocPrinterW.
TODO: Find a way to actually test the localspl.dll functions instead of only winspool.drv. This DLL doesn't like to be tested standalone under Windows, e.g. without being used through spoolsv/spoolss.
[SPOOLSS]
Implement InitializeRouter by calling the InitializePrintProvidor function of localspl there.
This function should later also initialize further Print Providers.
[SPOOLSV]
Call InitializeRouter when starting up the service.
[WINSPOOL]
Add dummy functions for EnumPrintProcessorDatatypesA/EnumPrintProcessorDatatypesW.
[All modules]
Fix printf format specifiers for errors (%lu) and statuses (%ld).
svn path=/branches/colins-printing-for-freedom/; revision=67847
2015-05-22 15:29:07 +00:00
|
|
|
|
|
|
|
// Count the required buffer size and the number of datatypes.
|
|
|
|
*pcbNeeded = 0;
|
|
|
|
*pcReturned = 0;
|
|
|
|
|
2015-06-28 15:51:32 +00:00
|
|
|
for (pCurrentDatatype = _pwszDatatypes; *pCurrentDatatype; pCurrentDatatype++)
|
Time to commit some Work-In-Progress stuff before my diff gets too large..
[LOCALSPL]
- Begin work on the Local Spooler. Return a structure with function pointers in InitializePrintProvidor.
- Design and document internal structures for managing LocalSpl Handles, Printer Handles, Printers, Print Jobs and Print Processors.
Manage Printers and Print Processors in Generic Tables, with one Job Queue per Printer managed as a Doubly Linked List.
- Implement LocalOpenPrinter, LocalEnumPrintProcessorDatatypes, LocalEnumPrintProcessors, LocalGetPrintProcessorDirectory, with focus on catching all corner cases.
Currently working on LocalStartDocPrinter.
- Build upon the documentation at http://www.undocprint.org/formats/winspool/shd to read and write .SHD files.
[WINPRINT]
Begin work on the Standard Print Processor. Implement EnumPrintProcessorDatatypesW.
[WINSPOOL_APITEST]
Add an API Test for winspool.drv, currently testing some corner cases of ClosePrinter, EnumPrintProcessorDatatypesW, GetPrintProcessorDirectoryW, OpenPrinterW, StartDocPrinterW.
TODO: Find a way to actually test the localspl.dll functions instead of only winspool.drv. This DLL doesn't like to be tested standalone under Windows, e.g. without being used through spoolsv/spoolss.
[SPOOLSS]
Implement InitializeRouter by calling the InitializePrintProvidor function of localspl there.
This function should later also initialize further Print Providers.
[SPOOLSV]
Call InitializeRouter when starting up the service.
[WINSPOOL]
Add dummy functions for EnumPrintProcessorDatatypesA/EnumPrintProcessorDatatypesW.
[All modules]
Fix printf format specifiers for errors (%lu) and statuses (%ld).
svn path=/branches/colins-printing-for-freedom/; revision=67847
2015-05-22 15:29:07 +00:00
|
|
|
{
|
|
|
|
cbDatatype = (wcslen(*pCurrentDatatype) + 1) * sizeof(WCHAR);
|
|
|
|
*pcbNeeded += sizeof(DATATYPES_INFO_1W) + cbDatatype;
|
2015-06-05 18:16:51 +00:00
|
|
|
|
|
|
|
// Also calculate the offset in the output buffer of the pointer to this datatype string.
|
2015-07-03 09:06:35 +00:00
|
|
|
*pCurrentOffset = dwDatatypeCount * sizeof(DATATYPES_INFO_1W) + FIELD_OFFSET(DATATYPES_INFO_1W, pName);
|
2015-06-05 18:16:51 +00:00
|
|
|
|
2015-07-03 09:06:35 +00:00
|
|
|
dwDatatypeCount++;
|
2015-06-05 18:16:51 +00:00
|
|
|
pCurrentOffset++;
|
Time to commit some Work-In-Progress stuff before my diff gets too large..
[LOCALSPL]
- Begin work on the Local Spooler. Return a structure with function pointers in InitializePrintProvidor.
- Design and document internal structures for managing LocalSpl Handles, Printer Handles, Printers, Print Jobs and Print Processors.
Manage Printers and Print Processors in Generic Tables, with one Job Queue per Printer managed as a Doubly Linked List.
- Implement LocalOpenPrinter, LocalEnumPrintProcessorDatatypes, LocalEnumPrintProcessors, LocalGetPrintProcessorDirectory, with focus on catching all corner cases.
Currently working on LocalStartDocPrinter.
- Build upon the documentation at http://www.undocprint.org/formats/winspool/shd to read and write .SHD files.
[WINPRINT]
Begin work on the Standard Print Processor. Implement EnumPrintProcessorDatatypesW.
[WINSPOOL_APITEST]
Add an API Test for winspool.drv, currently testing some corner cases of ClosePrinter, EnumPrintProcessorDatatypesW, GetPrintProcessorDirectoryW, OpenPrinterW, StartDocPrinterW.
TODO: Find a way to actually test the localspl.dll functions instead of only winspool.drv. This DLL doesn't like to be tested standalone under Windows, e.g. without being used through spoolsv/spoolss.
[SPOOLSS]
Implement InitializeRouter by calling the InitializePrintProvidor function of localspl there.
This function should later also initialize further Print Providers.
[SPOOLSV]
Call InitializeRouter when starting up the service.
[WINSPOOL]
Add dummy functions for EnumPrintProcessorDatatypesA/EnumPrintProcessorDatatypesW.
[All modules]
Fix printf format specifiers for errors (%lu) and statuses (%ld).
svn path=/branches/colins-printing-for-freedom/; revision=67847
2015-05-22 15:29:07 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
// Check if the supplied buffer is large enough.
|
|
|
|
if (cbBuf < *pcbNeeded)
|
|
|
|
{
|
2017-06-27 07:25:04 +00:00
|
|
|
SetLastError(ERROR_INSUFFICIENT_BUFFER);
|
|
|
|
return FALSE;
|
Time to commit some Work-In-Progress stuff before my diff gets too large..
[LOCALSPL]
- Begin work on the Local Spooler. Return a structure with function pointers in InitializePrintProvidor.
- Design and document internal structures for managing LocalSpl Handles, Printer Handles, Printers, Print Jobs and Print Processors.
Manage Printers and Print Processors in Generic Tables, with one Job Queue per Printer managed as a Doubly Linked List.
- Implement LocalOpenPrinter, LocalEnumPrintProcessorDatatypes, LocalEnumPrintProcessors, LocalGetPrintProcessorDirectory, with focus on catching all corner cases.
Currently working on LocalStartDocPrinter.
- Build upon the documentation at http://www.undocprint.org/formats/winspool/shd to read and write .SHD files.
[WINPRINT]
Begin work on the Standard Print Processor. Implement EnumPrintProcessorDatatypesW.
[WINSPOOL_APITEST]
Add an API Test for winspool.drv, currently testing some corner cases of ClosePrinter, EnumPrintProcessorDatatypesW, GetPrintProcessorDirectoryW, OpenPrinterW, StartDocPrinterW.
TODO: Find a way to actually test the localspl.dll functions instead of only winspool.drv. This DLL doesn't like to be tested standalone under Windows, e.g. without being used through spoolsv/spoolss.
[SPOOLSS]
Implement InitializeRouter by calling the InitializePrintProvidor function of localspl there.
This function should later also initialize further Print Providers.
[SPOOLSV]
Call InitializeRouter when starting up the service.
[WINSPOOL]
Add dummy functions for EnumPrintProcessorDatatypesA/EnumPrintProcessorDatatypesW.
[All modules]
Fix printf format specifiers for errors (%lu) and statuses (%ld).
svn path=/branches/colins-printing-for-freedom/; revision=67847
2015-05-22 15:29:07 +00:00
|
|
|
}
|
|
|
|
|
2015-06-05 18:16:51 +00:00
|
|
|
// Check if a buffer was supplied at all.
|
|
|
|
if (!pDatatypes)
|
Time to commit some Work-In-Progress stuff before my diff gets too large..
[LOCALSPL]
- Begin work on the Local Spooler. Return a structure with function pointers in InitializePrintProvidor.
- Design and document internal structures for managing LocalSpl Handles, Printer Handles, Printers, Print Jobs and Print Processors.
Manage Printers and Print Processors in Generic Tables, with one Job Queue per Printer managed as a Doubly Linked List.
- Implement LocalOpenPrinter, LocalEnumPrintProcessorDatatypes, LocalEnumPrintProcessors, LocalGetPrintProcessorDirectory, with focus on catching all corner cases.
Currently working on LocalStartDocPrinter.
- Build upon the documentation at http://www.undocprint.org/formats/winspool/shd to read and write .SHD files.
[WINPRINT]
Begin work on the Standard Print Processor. Implement EnumPrintProcessorDatatypesW.
[WINSPOOL_APITEST]
Add an API Test for winspool.drv, currently testing some corner cases of ClosePrinter, EnumPrintProcessorDatatypesW, GetPrintProcessorDirectoryW, OpenPrinterW, StartDocPrinterW.
TODO: Find a way to actually test the localspl.dll functions instead of only winspool.drv. This DLL doesn't like to be tested standalone under Windows, e.g. without being used through spoolsv/spoolss.
[SPOOLSS]
Implement InitializeRouter by calling the InitializePrintProvidor function of localspl there.
This function should later also initialize further Print Providers.
[SPOOLSV]
Call InitializeRouter when starting up the service.
[WINSPOOL]
Add dummy functions for EnumPrintProcessorDatatypesA/EnumPrintProcessorDatatypesW.
[All modules]
Fix printf format specifiers for errors (%lu) and statuses (%ld).
svn path=/branches/colins-printing-for-freedom/; revision=67847
2015-05-22 15:29:07 +00:00
|
|
|
{
|
2017-06-27 07:25:04 +00:00
|
|
|
SetLastError(ERROR_INVALID_PARAMETER);
|
|
|
|
return FALSE;
|
Time to commit some Work-In-Progress stuff before my diff gets too large..
[LOCALSPL]
- Begin work on the Local Spooler. Return a structure with function pointers in InitializePrintProvidor.
- Design and document internal structures for managing LocalSpl Handles, Printer Handles, Printers, Print Jobs and Print Processors.
Manage Printers and Print Processors in Generic Tables, with one Job Queue per Printer managed as a Doubly Linked List.
- Implement LocalOpenPrinter, LocalEnumPrintProcessorDatatypes, LocalEnumPrintProcessors, LocalGetPrintProcessorDirectory, with focus on catching all corner cases.
Currently working on LocalStartDocPrinter.
- Build upon the documentation at http://www.undocprint.org/formats/winspool/shd to read and write .SHD files.
[WINPRINT]
Begin work on the Standard Print Processor. Implement EnumPrintProcessorDatatypesW.
[WINSPOOL_APITEST]
Add an API Test for winspool.drv, currently testing some corner cases of ClosePrinter, EnumPrintProcessorDatatypesW, GetPrintProcessorDirectoryW, OpenPrinterW, StartDocPrinterW.
TODO: Find a way to actually test the localspl.dll functions instead of only winspool.drv. This DLL doesn't like to be tested standalone under Windows, e.g. without being used through spoolsv/spoolss.
[SPOOLSS]
Implement InitializeRouter by calling the InitializePrintProvidor function of localspl there.
This function should later also initialize further Print Providers.
[SPOOLSV]
Call InitializeRouter when starting up the service.
[WINSPOOL]
Add dummy functions for EnumPrintProcessorDatatypesA/EnumPrintProcessorDatatypesW.
[All modules]
Fix printf format specifiers for errors (%lu) and statuses (%ld).
svn path=/branches/colins-printing-for-freedom/; revision=67847
2015-05-22 15:29:07 +00:00
|
|
|
}
|
|
|
|
|
2015-06-05 18:16:51 +00:00
|
|
|
// Copy over all datatypes.
|
|
|
|
*pCurrentOffset = MAXDWORD;
|
2015-06-28 15:51:32 +00:00
|
|
|
PackStrings(_pwszDatatypes, pDatatypes, dwOffsets, &pDatatypes[*pcbNeeded]);
|
2015-06-05 18:16:51 +00:00
|
|
|
|
2015-07-03 09:06:35 +00:00
|
|
|
*pcReturned = dwDatatypeCount;
|
2017-06-27 07:25:04 +00:00
|
|
|
return TRUE;
|
Time to commit some Work-In-Progress stuff before my diff gets too large..
[LOCALSPL]
- Begin work on the Local Spooler. Return a structure with function pointers in InitializePrintProvidor.
- Design and document internal structures for managing LocalSpl Handles, Printer Handles, Printers, Print Jobs and Print Processors.
Manage Printers and Print Processors in Generic Tables, with one Job Queue per Printer managed as a Doubly Linked List.
- Implement LocalOpenPrinter, LocalEnumPrintProcessorDatatypes, LocalEnumPrintProcessors, LocalGetPrintProcessorDirectory, with focus on catching all corner cases.
Currently working on LocalStartDocPrinter.
- Build upon the documentation at http://www.undocprint.org/formats/winspool/shd to read and write .SHD files.
[WINPRINT]
Begin work on the Standard Print Processor. Implement EnumPrintProcessorDatatypesW.
[WINSPOOL_APITEST]
Add an API Test for winspool.drv, currently testing some corner cases of ClosePrinter, EnumPrintProcessorDatatypesW, GetPrintProcessorDirectoryW, OpenPrinterW, StartDocPrinterW.
TODO: Find a way to actually test the localspl.dll functions instead of only winspool.drv. This DLL doesn't like to be tested standalone under Windows, e.g. without being used through spoolsv/spoolss.
[SPOOLSS]
Implement InitializeRouter by calling the InitializePrintProvidor function of localspl there.
This function should later also initialize further Print Providers.
[SPOOLSV]
Call InitializeRouter when starting up the service.
[WINSPOOL]
Add dummy functions for EnumPrintProcessorDatatypesA/EnumPrintProcessorDatatypesW.
[All modules]
Fix printf format specifiers for errors (%lu) and statuses (%ld).
svn path=/branches/colins-printing-for-freedom/; revision=67847
2015-05-22 15:29:07 +00:00
|
|
|
}
|
2015-06-28 15:51:32 +00:00
|
|
|
|
|
|
|
|
|
|
|
DWORD WINAPI
|
|
|
|
GetPrintProcessorCapabilities(PWSTR pValueName, DWORD dwAttributes, PBYTE pData, DWORD nSize, PDWORD pcbNeeded)
|
|
|
|
{
|
2015-07-21 13:19:14 +00:00
|
|
|
TRACE("GetPrintProcessorCapabilities(%S, %lu, %p, %lu, %p)\n", pValueName, dwAttributes, pData, nSize, pcbNeeded);
|
|
|
|
|
2015-06-28 15:51:32 +00:00
|
|
|
UNIMPLEMENTED;
|
|
|
|
return 0;
|
|
|
|
}
|
|
|
|
|
|
|
|
/**
|
|
|
|
* @name OpenPrintProcessor
|
|
|
|
*
|
|
|
|
* Prepares this Print Processor for processing a document.
|
|
|
|
*
|
|
|
|
* @param pPrinterName
|
|
|
|
* String in the format "\\COMPUTERNAME\Port:, Port" that is passed to OpenPrinterW for writing to the Print Monitor on the specified port.
|
|
|
|
*
|
|
|
|
* @param pPrintProcessorOpenData
|
|
|
|
* Pointer to a PRINTPROCESSOROPENDATA structure containing details about the print job to be processed.
|
|
|
|
*
|
|
|
|
* @return
|
|
|
|
* A Print Processor handle on success or NULL in case of a failure. This handle has to be passed to PrintDocumentOnPrintProcessor to do the actual processing.
|
|
|
|
* A more specific error code can be obtained through GetLastError.
|
|
|
|
*/
|
|
|
|
HANDLE WINAPI
|
|
|
|
OpenPrintProcessor(PWSTR pPrinterName, PPRINTPROCESSOROPENDATA pPrintProcessorOpenData)
|
|
|
|
{
|
|
|
|
DWORD dwErrorCode;
|
|
|
|
HANDLE hReturnValue = NULL;
|
|
|
|
PWINPRINT_HANDLE pHandle = NULL;
|
|
|
|
|
2015-07-21 13:19:14 +00:00
|
|
|
TRACE("OpenPrintProcessor(%S, %p)\n", pPrinterName, pPrintProcessorOpenData);
|
|
|
|
|
2015-06-28 15:51:32 +00:00
|
|
|
// Sanity checks
|
|
|
|
// This time a datatype needs to be given. We can't fall back to a default here.
|
|
|
|
if (!pPrintProcessorOpenData || !pPrintProcessorOpenData->pDatatype || !*pPrintProcessorOpenData->pDatatype)
|
|
|
|
{
|
|
|
|
dwErrorCode = ERROR_INVALID_PARAMETER;
|
|
|
|
goto Cleanup;
|
|
|
|
}
|
|
|
|
|
2015-06-30 16:02:26 +00:00
|
|
|
// Create a new WINPRINT_HANDLE structure and fill the relevant fields.
|
2015-06-28 15:51:32 +00:00
|
|
|
pHandle = DllAllocSplMem(sizeof(WINPRINT_HANDLE));
|
|
|
|
|
|
|
|
// Check what datatype was given.
|
|
|
|
if (wcsicmp(pPrintProcessorOpenData->pDatatype, L"RAW") == 0)
|
|
|
|
{
|
|
|
|
pHandle->Datatype = RAW;
|
|
|
|
}
|
|
|
|
else
|
|
|
|
{
|
|
|
|
dwErrorCode = ERROR_INVALID_DATATYPE;
|
|
|
|
goto Cleanup;
|
|
|
|
}
|
|
|
|
|
|
|
|
// Fill the relevant fields.
|
|
|
|
pHandle->dwJobID = pPrintProcessorOpenData->JobId;
|
|
|
|
pHandle->pwszDatatype = AllocSplStr(pPrintProcessorOpenData->pDatatype);
|
|
|
|
pHandle->pwszDocumentName = AllocSplStr(pPrintProcessorOpenData->pDocumentName);
|
|
|
|
pHandle->pwszOutputFile = AllocSplStr(pPrintProcessorOpenData->pOutputFile);
|
2015-07-15 15:53:04 +00:00
|
|
|
pHandle->pwszPrinterPort = AllocSplStr(pPrinterName);
|
2015-06-28 15:51:32 +00:00
|
|
|
|
|
|
|
// We were successful! Return the handle and don't let the cleanup routine free it.
|
|
|
|
dwErrorCode = ERROR_SUCCESS;
|
|
|
|
hReturnValue = pHandle;
|
|
|
|
pHandle = NULL;
|
|
|
|
|
|
|
|
Cleanup:
|
|
|
|
if (pHandle)
|
|
|
|
DllFreeSplMem(pHandle);
|
|
|
|
|
|
|
|
SetLastError(dwErrorCode);
|
|
|
|
return hReturnValue;
|
|
|
|
}
|
|
|
|
|
|
|
|
/**
|
|
|
|
* @name PrintDocumentOnPrintProcessor
|
|
|
|
*
|
|
|
|
* Prints a document on this Print Processor after a handle for the document has been opened through OpenPrintProcessor.
|
|
|
|
*
|
|
|
|
* @param hPrintProcessor
|
|
|
|
* The return value of a previous successful OpenPrintProcessor call.
|
|
|
|
*
|
|
|
|
* @param pDocumentName
|
|
|
|
* String in the format "Printer, Job N" describing the spooled job that is to be processed.
|
|
|
|
*
|
|
|
|
* @return
|
|
|
|
* TRUE if the document was successfully processed by this Print Processor, FALSE otherwise.
|
|
|
|
* A more specific error code can be obtained through GetLastError.
|
|
|
|
*/
|
|
|
|
BOOL WINAPI
|
|
|
|
PrintDocumentOnPrintProcessor(HANDLE hPrintProcessor, PWSTR pDocumentName)
|
|
|
|
{
|
|
|
|
DWORD dwErrorCode;
|
|
|
|
PWINPRINT_HANDLE pHandle;
|
|
|
|
|
2015-07-21 13:19:14 +00:00
|
|
|
TRACE("PrintDocumentOnPrintProcessor(%p, %S)\n", hPrintProcessor, pDocumentName);
|
|
|
|
|
2015-06-28 15:51:32 +00:00
|
|
|
// Sanity checks
|
|
|
|
if (!hPrintProcessor)
|
|
|
|
{
|
|
|
|
dwErrorCode = ERROR_INVALID_HANDLE;
|
|
|
|
goto Cleanup;
|
|
|
|
}
|
|
|
|
|
|
|
|
pHandle = (PWINPRINT_HANDLE)hPrintProcessor;
|
|
|
|
|
|
|
|
// Call the corresponding Print function for the datatype.
|
|
|
|
if (pHandle->Datatype == RAW)
|
|
|
|
dwErrorCode = PrintRawJob(pHandle, pDocumentName);
|
|
|
|
|
|
|
|
Cleanup:
|
|
|
|
SetLastError(dwErrorCode);
|
|
|
|
return (dwErrorCode == ERROR_SUCCESS);
|
|
|
|
}
|